C20H36N4O2 — CID 100938462
2-[bis(dimethylamino)methylidene]-N,N'-dicyclohexylpropanediamide (PubChem CID 100938462) has the molecular formula C20H36N4O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-[bis(dimethylamino)methylidene]-N,N'-dicyclohexylpropanediamide.
| Compound Name | 2-[bis(dimethylamino)methylidene]-N,N'-dicyclohexylpropanediamide |
|---|---|
| PubChem CID | 100938462 |
| Molecular Formula | C20H36N4O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | 2-[bis(dimethylamino)methylidene]-N,N'-dicyclohexylpropanediamide |
| SMILES | CN(C)C(=C(C(=O)NC1CCCCC1)C(=O)NC1CCCCC1)N(C)C |
| InChI | InChI=1S/C20H36N4O2/c1-23(2)20(24(3)4)17(18(25)21-15-11-7-5-8-12-15)19(26)22-16-13-9-6-10-14-16/h15-16H,5-14H2,1-4H3,(H,21,25)(H,22,26) |
| InChIKey | ZHIOXENKTYAWGQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|