C13H28N2O3 — CID 142518956
acetic acid;3-cyclohexyl-1,1-dimethylurea;ethane (PubChem CID 142518956) has the molecular formula C13H28N2O3 and a molecular weight of 260.38 g/mol. Its IUPAC name is acetic acid;3-cyclohexyl-1,1-dimethylurea;ethane.
| Compound Name | acetic acid;3-cyclohexyl-1,1-dimethylurea;ethane |
|---|---|
| PubChem CID | 142518956 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | acetic acid;3-cyclohexyl-1,1-dimethylurea;ethane |
| SMILES | CC.CC(=O)O.CN(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C9H18N2O.C2H4O2.C2H6/c1-11(2)9(12)10-8-6-4-3-5-7-8;1-2(3)4;1-2/h8H,3-7H2,1-2H3,(H,10,12);1H3,(H,3,4);1-2H3 |
| InChIKey | COVFXGWIZCEHIL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |