C15H20BrN3O2 — CID 108507327
N-(2-bromophenyl)-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide (PubChem CID 108507327) has the molecular formula C15H20BrN3O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide.
| Compound Name | N-(2-bromophenyl)-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 108507327 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-(2-bromophenyl)-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide |
| SMILES | CN1CCC(N(C)C(=O)C(=O)Nc2ccccc2Br)CC1 |
| InChI | InChI=1S/C15H20BrN3O2/c1-18-9-7-11(8-10-18)19(2)15(21)14(20)17-13-6-4-3-5-12(13)16/h3-6,11H,7-10H2,1-2H3,(H,17,20) |
| InChIKey | QSUGPJRXMITPAJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|