C14H19BrN2O2 — CID 123664942
N-(2-bromophenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide;ethane (PubChem CID 123664942) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is N-(2-bromophenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide;ethane.
| Compound Name | N-(2-bromophenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 123664942 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | N-(2-bromophenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide;ethane |
| SMILES | CC.CN1CCC(C(=O)Nc2ccccc2Br)C1=O |
| InChI | InChI=1S/C12H13BrN2O2.C2H6/c1-15-7-6-8(12(15)17)11(16)14-10-5-3-2-4-9(10)13;1-2/h2-5,8H,6-7H2,1H3,(H,14,16);1-2H3 |
| InChIKey | OZOSGJJUENHKMB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|