C19H28N2O2 — CID 108503858
N-(2-butan-2-ylphenyl)-N'-cyclohexyl-N'-methyloxamide (PubChem CID 108503858) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is N-(2-butan-2-ylphenyl)-N'-cyclohexyl-N'-methyloxamide.
| Compound Name | N-(2-butan-2-ylphenyl)-N'-cyclohexyl-N'-methyloxamide |
|---|---|
| PubChem CID | 108503858 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | N-(2-butan-2-ylphenyl)-N'-cyclohexyl-N'-methyloxamide |
| SMILES | CCC(C)c1ccccc1NC(=O)C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C19H28N2O2/c1-4-14(2)16-12-8-9-13-17(16)20-18(22)19(23)21(3)15-10-6-5-7-11-15/h8-9,12-15H,4-7,10-11H2,1-3H3,(H,20,22) |
| InChIKey | IPRGTKBBRBLUBK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|