C22H22N2O3 — CID 108509432
N-(2-butan-2-ylphenyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide (PubChem CID 108509432) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-(2-butan-2-ylphenyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide.
| Compound Name | N-(2-butan-2-ylphenyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide |
|---|---|
| PubChem CID | 108509432 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-(2-butan-2-ylphenyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide |
| SMILES | CCC(C)c1ccccc1NC(=O)C(=O)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C22H22N2O3/c1-3-14(2)15-8-4-5-11-18(15)23-21(26)22(27)24-19-12-6-10-17-16(19)9-7-13-20(17)25/h4-14,25H,3H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | PNHPPSLPXFJEBV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|