C19H22N2O3 — CID 108509668
N'-(2-butan-2-ylphenyl)-N-(4-hydroxy-2-methylphenyl)oxamide (PubChem CID 108509668) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N'-(2-butan-2-ylphenyl)-N-(4-hydroxy-2-methylphenyl)oxamide.
| Compound Name | N'-(2-butan-2-ylphenyl)-N-(4-hydroxy-2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108509668 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N'-(2-butan-2-ylphenyl)-N-(4-hydroxy-2-methylphenyl)oxamide |
| SMILES | CCC(C)c1ccccc1NC(=O)C(=O)Nc1ccc(O)cc1C |
| InChI | InChI=1S/C19H22N2O3/c1-4-12(2)15-7-5-6-8-17(15)21-19(24)18(23)20-16-10-9-14(22)11-13(16)3/h5-12,22H,4H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | MOTPNVPWJCMIDU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|