C22H24N2O6 — CID 108524500
dimethyl 2-[[2-(2-butan-2-ylanilino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 108524500) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is dimethyl 2-[[2-(2-butan-2-ylanilino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(2-butan-2-ylanilino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108524500 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | dimethyl 2-[[2-(2-butan-2-ylanilino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | CCC(C)c1ccccc1NC(=O)C(=O)Nc1cc(C(=O)OC)ccc1C(=O)OC |
| InChI | InChI=1S/C22H24N2O6/c1-5-13(2)15-8-6-7-9-17(15)23-19(25)20(26)24-18-12-14(21(27)29-3)10-11-16(18)22(28)30-4/h6-13H,5H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | GFZNBIITGKFNOX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|