C21H18N2O5 — CID 108884661
dimethyl 2-(naphthalen-1-ylcarbamoylamino)benzene-1,4-dicarboxylate (PubChem CID 108884661) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is dimethyl 2-(naphthalen-1-ylcarbamoylamino)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(naphthalen-1-ylcarbamoylamino)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108884661 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | dimethyl 2-(naphthalen-1-ylcarbamoylamino)benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)Nc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C21H18N2O5/c1-27-19(24)14-10-11-16(20(25)28-2)18(12-14)23-21(26)22-17-9-5-7-13-6-3-4-8-15(13)17/h3-12H,1-2H3,(H2,22,23,26) |
| InChIKey | VTESWAMXNZLDHV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |