C24H23NO6 — CID 43915556
dimethyl 2-(2-naphthalen-2-yloxybutanoylamino)benzene-1,4-dicarboxylate (PubChem CID 43915556) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is dimethyl 2-(2-naphthalen-2-yloxybutanoylamino)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(2-naphthalen-2-yloxybutanoylamino)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 43915556 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | dimethyl 2-(2-naphthalen-2-yloxybutanoylamino)benzene-1,4-dicarboxylate |
| SMILES | CCC(Oc1ccc2ccccc2c1)C(=O)Nc1cc(C(=O)OC)ccc1C(=O)OC |
| InChI | InChI=1S/C24H23NO6/c1-4-21(31-18-11-9-15-7-5-6-8-16(15)13-18)22(26)25-20-14-17(23(27)29-2)10-12-19(20)24(28)30-3/h5-14,21H,4H2,1-3H3,(H,25,26) |
| InChIKey | NHYDLRQSSSDRFM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |