C23H22ClNO4 — CID 93486347
ethyl 3-chloro-4-[[(2R)-2-naphthalen-2-yloxybutanoyl]amino]benzoate (PubChem CID 93486347) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is ethyl 3-chloro-4-[[(2R)-2-naphthalen-2-yloxybutanoyl]amino]benzoate.
| Compound Name | ethyl 3-chloro-4-[[(2R)-2-naphthalen-2-yloxybutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 93486347 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | ethyl 3-chloro-4-[[(2R)-2-naphthalen-2-yloxybutanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@@H](CC)Oc2ccc3ccccc3c2)c(Cl)c1 |
| InChI | InChI=1S/C23H22ClNO4/c1-3-21(29-18-11-9-15-7-5-6-8-16(15)13-18)22(26)25-20-12-10-17(14-19(20)24)23(27)28-4-2/h5-14,21H,3-4H2,1-2H3,(H,25,26)/t21-/m1/s1 |
| InChIKey | WIBCPIPJKVLZBM-OAQYLSRUSA-N |
| XLogP | 5.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |