C21H24ClNO4 — CID 99957135
ethyl 3-chloro-4-[[(2R)-2-(2-propan-2-ylphenoxy)propanoyl]amino]benzoate (PubChem CID 99957135) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is ethyl 3-chloro-4-[[(2R)-2-(2-propan-2-ylphenoxy)propanoyl]amino]benzoate.
| Compound Name | ethyl 3-chloro-4-[[(2R)-2-(2-propan-2-ylphenoxy)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 99957135 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | ethyl 3-chloro-4-[[(2R)-2-(2-propan-2-ylphenoxy)propanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@@H](C)Oc2ccccc2C(C)C)c(Cl)c1 |
| InChI | InChI=1S/C21H24ClNO4/c1-5-26-21(25)15-10-11-18(17(22)12-15)23-20(24)14(4)27-19-9-7-6-8-16(19)13(2)3/h6-14H,5H2,1-4H3,(H,23,24)/t14-/m1/s1 |
| InChIKey | JULPBZDKKRZWDZ-CQSZACIVSA-N |
| XLogP | 5.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |