C18H18N2O6 — CID 108866342
dimethyl 2-[(4-methoxyphenyl)carbamoylamino]benzene-1,4-dicarboxylate (PubChem CID 108866342) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is dimethyl 2-[(4-methoxyphenyl)carbamoylamino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(4-methoxyphenyl)carbamoylamino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108866342 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | dimethyl 2-[(4-methoxyphenyl)carbamoylamino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)Nc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C18H18N2O6/c1-24-13-7-5-12(6-8-13)19-18(23)20-15-10-11(16(21)25-2)4-9-14(15)17(22)26-3/h4-10H,1-3H3,(H2,19,20,23) |
| InChIKey | ONOFPHINCJEJKU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |