C17H25N3O2 — CID 108505781
N'-methyl-N'-(1-methylpiperidin-4-yl)-N-(2-phenylethyl)oxamide (PubChem CID 108505781) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N'-methyl-N'-(1-methylpiperidin-4-yl)-N-(2-phenylethyl)oxamide.
| Compound Name | N'-methyl-N'-(1-methylpiperidin-4-yl)-N-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 108505781 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N'-methyl-N'-(1-methylpiperidin-4-yl)-N-(2-phenylethyl)oxamide |
| SMILES | CN1CCC(N(C)C(=O)C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-19-12-9-15(10-13-19)20(2)17(22)16(21)18-11-8-14-6-4-3-5-7-14/h3-7,15H,8-13H2,1-2H3,(H,18,21) |
| InChIKey | ICOWVJNMRMHERO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|