C16H22ClN3O2 — CID 108506051
N-[(2-chlorophenyl)methyl]-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide (PubChem CID 108506051) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 108506051 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide |
| SMILES | CN1CCC(N(C)C(=O)C(=O)NCc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C16H22ClN3O2/c1-19-9-7-13(8-10-19)20(2)16(22)15(21)18-11-12-5-3-4-6-14(12)17/h3-6,13H,7-11H2,1-2H3,(H,18,21) |
| InChIKey | SHOVMZBFYREEPI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|