C14H18ClNO — CID 166712612
2-(2-chlorophenyl)-N-cyclopentyl-N-methylacetamide (PubChem CID 166712612) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-cyclopentyl-N-methylacetamide.
| Compound Name | 2-(2-chlorophenyl)-N-cyclopentyl-N-methylacetamide |
|---|---|
| PubChem CID | 166712612 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-(2-chlorophenyl)-N-cyclopentyl-N-methylacetamide |
| SMILES | CN(C(=O)Cc1ccccc1Cl)C1CCCC1 |
| InChI | InChI=1S/C14H18ClNO/c1-16(12-7-3-4-8-12)14(17)10-11-6-2-5-9-13(11)15/h2,5-6,9,12H,3-4,7-8,10H2,1H3 |
| InChIKey | KASXSDJNSVGBEP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |