C14H18ClNO2 — CID 110733181
2-(2-chlorophenyl)-N-methyl-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 110733181) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-methyl-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-methyl-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 110733181 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-(2-chlorophenyl)-N-methyl-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CN(CC1CCCO1)C(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C14H18ClNO2/c1-16(10-12-6-4-8-18-12)14(17)9-11-5-2-3-7-13(11)15/h2-3,5,7,12H,4,6,8-10H2,1H3 |
| InChIKey | BZRJAUNFJXCGHL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |