C16H19ClF3N3O2 — CID 108507170
N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide (PubChem CID 108507170) has the molecular formula C16H19ClF3N3O2 and a molecular weight of 377.79 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 108507170 |
| Molecular Formula | C16H19ClF3N3O2 |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide |
| SMILES | CN1CCC(N(C)C(=O)C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H19ClF3N3O2/c1-22-7-5-11(6-8-22)23(2)15(25)14(24)21-10-3-4-13(17)12(9-10)16(18,19)20/h3-4,9,11H,5-8H2,1-2H3,(H,21,24) |
| InChIKey | RKQGGMVORYOBOT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|