C17H20ClF3N2O2 — CID 108958892
N-[4-chloro-3-(trifluoromethyl)phenyl]-2,2-dimethyl-3-oxo-3-piperidin-1-ylpropanamide (PubChem CID 108958892) has the molecular formula C17H20ClF3N2O2 and a molecular weight of 376.81 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2,2-dimethyl-3-oxo-3-piperidin-1-ylpropanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2,2-dimethyl-3-oxo-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 108958892 |
| Molecular Formula | C17H20ClF3N2O2 |
| Molecular Weight | 376.81 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2,2-dimethyl-3-oxo-3-piperidin-1-ylpropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H20ClF3N2O2/c1-16(2,15(25)23-8-4-3-5-9-23)14(24)22-11-6-7-13(18)12(10-11)17(19,20)21/h6-7,10H,3-5,8-9H2,1-2H3,(H,22,24) |
| InChIKey | OFERGHBOFDSUTR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.81 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|