C15H18ClF3N2O — CID 109013943
N-[4-chloro-3-(trifluoromethyl)phenyl]-3-piperidin-1-ylpropanamide (PubChem CID 109013943) has the molecular formula C15H18ClF3N2O and a molecular weight of 334.77 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 109013943 |
| Molecular Formula | C15H18ClF3N2O |
| Molecular Weight | 334.77 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-piperidin-1-ylpropanamide |
| SMILES | O=C(CCN1CCCCC1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18ClF3N2O/c16-13-5-4-11(10-12(13)15(17,18)19)20-14(22)6-9-21-7-2-1-3-8-21/h4-5,10H,1-3,6-9H2,(H,20,22) |
| InChIKey | QOALHYJEMWEATP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |