C15H14ClF3N2O3 — CID 2219815
N-[4-chloro-3-(trifluoromethyl)phenyl]-4-(2,5-dioxopyrrolidin-1-yl)butanamide (PubChem CID 2219815) has the molecular formula C15H14ClF3N2O3 and a molecular weight of 362.74 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-4-(2,5-dioxopyrrolidin-1-yl)butanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-(2,5-dioxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 2219815 |
| Molecular Formula | C15H14ClF3N2O3 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-(2,5-dioxopyrrolidin-1-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)CCC1=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14ClF3N2O3/c16-11-4-3-9(8-10(11)15(17,18)19)20-12(22)2-1-7-21-13(23)5-6-14(21)24/h3-4,8H,1-2,5-7H2,(H,20,22) |
| InChIKey | OMMFBWZIYLNSDR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|