C13H13ClF3N3O3 — CID 108515874
N'-acetyl-N'-(2-aminoethyl)-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide (PubChem CID 108515874) has the molecular formula C13H13ClF3N3O3 and a molecular weight of 351.71 g/mol. Its IUPAC name is N'-acetyl-N'-(2-aminoethyl)-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-acetyl-N'-(2-aminoethyl)-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 108515874 |
| Molecular Formula | C13H13ClF3N3O3 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N'-acetyl-N'-(2-aminoethyl)-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide |
| SMILES | CC(=O)N(CCN)C(=O)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13ClF3N3O3/c1-7(21)20(5-4-18)12(23)11(22)19-8-2-3-10(14)9(6-8)13(15,16)17/h2-3,6H,4-5,18H2,1H3,(H,19,22) |
| InChIKey | YAXRXEBPLZVXBS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|