C17H15ClF3N3O2 — CID 108985659
N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-methyl-N'-(2-pyridin-4-ylethyl)oxamide (PubChem CID 108985659) has the molecular formula C17H15ClF3N3O2 and a molecular weight of 385.77 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-methyl-N'-(2-pyridin-4-ylethyl)oxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-methyl-N'-(2-pyridin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108985659 |
| Molecular Formula | C17H15ClF3N3O2 |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-methyl-N'-(2-pyridin-4-ylethyl)oxamide |
| SMILES | CN(CCc1ccncc1)C(=O)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15ClF3N3O2/c1-24(9-6-11-4-7-22-8-5-11)16(26)15(25)23-12-2-3-14(18)13(10-12)17(19,20)21/h2-5,7-8,10H,6,9H2,1H3,(H,23,25) |
| InChIKey | HTHHFCZSHOZFSS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|