C19H18ClF3N2O2 — CID 108503417
N'-benzyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-propan-2-yloxamide (PubChem CID 108503417) has the molecular formula C19H18ClF3N2O2 and a molecular weight of 398.81 g/mol. Its IUPAC name is N'-benzyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-propan-2-yloxamide.
| Compound Name | N'-benzyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 108503417 |
| Molecular Formula | C19H18ClF3N2O2 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N'-benzyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-propan-2-yloxamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18ClF3N2O2/c1-12(2)25(11-13-6-4-3-5-7-13)18(27)17(26)24-14-8-9-16(20)15(10-14)19(21,22)23/h3-10,12H,11H2,1-2H3,(H,24,26) |
| InChIKey | RPMZLIKYRRKYAR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|