C20H23ClN2O2 — CID 108503582
N'-benzyl-N-(2-chloro-4,6-dimethylphenyl)-N'-propan-2-yloxamide (PubChem CID 108503582) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is N'-benzyl-N-(2-chloro-4,6-dimethylphenyl)-N'-propan-2-yloxamide.
| Compound Name | N'-benzyl-N-(2-chloro-4,6-dimethylphenyl)-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 108503582 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N'-benzyl-N-(2-chloro-4,6-dimethylphenyl)-N'-propan-2-yloxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)N(Cc2ccccc2)C(C)C)c(Cl)c1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-13(2)23(12-16-8-6-5-7-9-16)20(25)19(24)22-18-15(4)10-14(3)11-17(18)21/h5-11,13H,12H2,1-4H3,(H,22,24) |
| InChIKey | GTMNWHQCBKTTHO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|