C19H21ClN2O2 — CID 108532234
N-(2-chloro-4,6-dimethylphenyl)-N'-ethyl-N'-(3-methylphenyl)oxamide (PubChem CID 108532234) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-N'-ethyl-N'-(3-methylphenyl)oxamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-N'-ethyl-N'-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108532234 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-N'-ethyl-N'-(3-methylphenyl)oxamide |
| SMILES | CCN(C(=O)C(=O)Nc1c(C)cc(C)cc1Cl)c1cccc(C)c1 |
| InChI | InChI=1S/C19H21ClN2O2/c1-5-22(15-8-6-7-12(2)10-15)19(24)18(23)21-17-14(4)9-13(3)11-16(17)20/h6-11H,5H2,1-4H3,(H,21,23) |
| InChIKey | QXULPJUTITUBLR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|