About N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide
N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide (PubChem CID 108513389) has the molecular formula C17H17N3O4
and a molecular weight of 327.34 g/mol. Its IUPAC name is N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide.
Molecular Properties
| Compound Name | N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide |
| PubChem CID | 108513389 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide |
| SMILES | CCN(C(=O)C(=O)Nc1cccc([N+](=O)[O-])c1)c1cccc(C)c1 |
| InChI | InChI=1S/C17H17N3O4/c1-3-19(14-8-4-6-12(2)10-14)17(22)16(21)18-13-7-5-9-15(11-13)20(23)24/h4-11H,3H2,1-2H3,(H,18,21) |
| InChIKey | XMSNMKJDTGIKQB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide?
The IUPAC name of N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide (CID 108513389) is N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide.
What is the SMILES notation for N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide?
The canonical SMILES for N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide is CCN(C(=O)C(=O)Nc1cccc([N+](=O)[O-])c1)c1cccc(C)c1.
What is the InChIKey of N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide?
The InChIKey is XMSNMKJDTGIKQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O4/c1-3-19(14-8-4-6-12(2)10-14)17(22)16(21)18-13-7-5-9-15(11-13)20(23)24/h4-11H,3H2,1-2H3,(H,18,21).
What are the key properties of N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide?
N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide has a molecular weight of 327.34 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-(3-methylphenyl)-N-(3-nitrophenyl)oxamide is sourced from PubChem (CID 108513389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).