About N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide
N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide (PubChem CID 108532435) has the molecular formula C18H19N3O5
and a molecular weight of 357.37 g/mol. Its IUPAC name is N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide.
Molecular Properties
| Compound Name | N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide |
| PubChem CID | 108532435 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide |
| SMILES | CCN(C(=O)C(=O)Nc1cc([N+](=O)[O-])ccc1OC)c1cccc(C)c1 |
| InChI | InChI=1S/C18H19N3O5/c1-4-20(13-7-5-6-12(2)10-13)18(23)17(22)19-15-11-14(21(24)25)8-9-16(15)26-3/h5-11H,4H2,1-3H3,(H,19,22) |
| InChIKey | OIIJTQCCKQKHEG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide?
The IUPAC name of N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide (CID 108532435) is N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide.
What is the SMILES notation for N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide?
The canonical SMILES for N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide is CCN(C(=O)C(=O)Nc1cc([N+](=O)[O-])ccc1OC)c1cccc(C)c1.
What is the InChIKey of N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide?
The InChIKey is OIIJTQCCKQKHEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O5/c1-4-20(13-7-5-6-12(2)10-13)18(23)17(22)19-15-11-14(21(24)25)8-9-16(15)26-3/h5-11H,4H2,1-3H3,(H,19,22).
What are the key properties of N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide?
N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide has a molecular weight of 357.37 g/mol, XLogP of 2.90, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N-(2-methoxy-5-nitrophenyl)-N'-(3-methylphenyl)oxamide is sourced from PubChem (CID 108532435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).