C14H19N3O5 — CID 108528561
N'-butyl-N-(2-methoxy-5-nitrophenyl)-N'-methyloxamide (PubChem CID 108528561) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is N'-butyl-N-(2-methoxy-5-nitrophenyl)-N'-methyloxamide.
| Compound Name | N'-butyl-N-(2-methoxy-5-nitrophenyl)-N'-methyloxamide |
|---|---|
| PubChem CID | 108528561 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N'-butyl-N-(2-methoxy-5-nitrophenyl)-N'-methyloxamide |
| SMILES | CCCCN(C)C(=O)C(=O)Nc1cc([N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C14H19N3O5/c1-4-5-8-16(2)14(19)13(18)15-11-9-10(17(20)21)6-7-12(11)22-3/h6-7,9H,4-5,8H2,1-3H3,(H,15,18) |
| InChIKey | MGZHHEZHCCTGIJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|