C26H25N3O2S — CID 108503570
N'-benzyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-N'-propan-2-yloxamide (PubChem CID 108503570) has the molecular formula C26H25N3O2S and a molecular weight of 443.57 g/mol. Its IUPAC name is N'-benzyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-N'-propan-2-yloxamide.
| Compound Name | N'-benzyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 108503570 |
| Molecular Formula | C26H25N3O2S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N'-benzyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-N'-propan-2-yloxamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)C(=O)N(Cc4ccccc4)C(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C26H25N3O2S/c1-17(2)29(16-19-7-5-4-6-8-19)26(31)24(30)27-21-12-10-20(11-13-21)25-28-22-14-9-18(3)15-23(22)32-25/h4-15,17H,16H2,1-3H3,(H,27,30) |
| InChIKey | JGRSTJXMWWBZQX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|