C22H24ClN3O — CID 108830118
(Z)-N-benzyl-3-(2-chloro-4,6-dimethylanilino)-2-cyano-N-propan-2-ylprop-2-enamide (PubChem CID 108830118) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is (Z)-N-benzyl-3-(2-chloro-4,6-dimethylanilino)-2-cyano-N-propan-2-ylprop-2-enamide.
| Compound Name | (Z)-N-benzyl-3-(2-chloro-4,6-dimethylanilino)-2-cyano-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 108830118 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (Z)-N-benzyl-3-(2-chloro-4,6-dimethylanilino)-2-cyano-N-propan-2-ylprop-2-enamide |
| SMILES | Cc1cc(C)c(N/C=C(/C#N)C(=O)N(Cc2ccccc2)C(C)C)c(Cl)c1 |
| InChI | InChI=1S/C22H24ClN3O/c1-15(2)26(14-18-8-6-5-7-9-18)22(27)19(12-24)13-25-21-17(4)10-16(3)11-20(21)23/h5-11,13,15,25H,14H2,1-4H3/b19-13- |
| InChIKey | ZAQHTXFFAALDNZ-UYRXBGFRSA-N |
| XLogP | 5.21 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|