C14H16ClF3N4O2 — CID 108515917
N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-(4-methylpiperazin-1-yl)oxamide (PubChem CID 108515917) has the molecular formula C14H16ClF3N4O2 and a molecular weight of 364.76 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-(4-methylpiperazin-1-yl)oxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-(4-methylpiperazin-1-yl)oxamide |
|---|---|
| PubChem CID | 108515917 |
| Molecular Formula | C14H16ClF3N4O2 |
| Molecular Weight | 364.76 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-(4-methylpiperazin-1-yl)oxamide |
| SMILES | CN1CCN(NC(=O)C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H16ClF3N4O2/c1-21-4-6-22(7-5-21)20-13(24)12(23)19-9-2-3-11(15)10(8-9)14(16,17)18/h2-3,8H,4-7H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | SDAYJIMHEODCCA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.76 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|