C13H12ClF3N2O3 — CID 108509700
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-morpholin-4-yl-2-oxoacetamide (PubChem CID 108509700) has the molecular formula C13H12ClF3N2O3 and a molecular weight of 336.70 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-morpholin-4-yl-2-oxoacetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-morpholin-4-yl-2-oxoacetamide |
|---|---|
| PubChem CID | 108509700 |
| Molecular Formula | C13H12ClF3N2O3 |
| Molecular Weight | 336.70 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-morpholin-4-yl-2-oxoacetamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H12ClF3N2O3/c14-10-2-1-8(7-9(10)13(15,16)17)18-11(20)12(21)19-3-5-22-6-4-19/h1-2,7H,3-6H2,(H,18,20) |
| InChIKey | ZPLKWHPRMYPLQO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.70 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|