C17H31N3O4S — CID 108527178
N-cycloheptyl-N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)oxamide (PubChem CID 108527178) has the molecular formula C17H31N3O4S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-cycloheptyl-N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)oxamide.
| Compound Name | N-cycloheptyl-N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)oxamide |
|---|---|
| PubChem CID | 108527178 |
| Molecular Formula | C17H31N3O4S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-cycloheptyl-N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)oxamide |
| SMILES | CN(C)CCN(C(=O)C(=O)NC1CCCCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H31N3O4S/c1-19(2)10-11-20(15-9-12-25(23,24)13-15)17(22)16(21)18-14-7-5-3-4-6-8-14/h14-15H,3-13H2,1-2H3,(H,18,21) |
| InChIKey | RUPJCXRGLOWYTN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|