C17H28N4O3S — CID 108835603
(Z)-2-cyano-N-cyclopentyl-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]prop-2-enamide (PubChem CID 108835603) has the molecular formula C17H28N4O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclopentyl-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclopentyl-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108835603 |
| Molecular Formula | C17H28N4O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (Z)-2-cyano-N-cyclopentyl-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]prop-2-enamide |
| SMILES | CN(C)CCN(/C=C(/C#N)C(=O)NC1CCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H28N4O3S/c1-20(2)8-9-21(16-7-10-25(23,24)13-16)12-14(11-18)17(22)19-15-5-3-4-6-15/h12,15-16H,3-10,13H2,1-2H3,(H,19,22)/b14-12- |
| InChIKey | ZPMICUPUCCLNIT-OWBHPGMISA-N |
| XLogP | 0.50 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|