C18H24N4O4S — CID 108855307
(Z)-2-cyano-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]-N-(2-hydroxyphenyl)prop-2-enamide (PubChem CID 108855307) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]-N-(2-hydroxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]-N-(2-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108855307 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (Z)-2-cyano-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]-N-(2-hydroxyphenyl)prop-2-enamide |
| SMILES | CN(C)CCN(/C=C(/C#N)C(=O)Nc1ccccc1O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H24N4O4S/c1-21(2)8-9-22(15-7-10-27(25,26)13-15)12-14(11-19)18(24)20-16-5-3-4-6-17(16)23/h3-6,12,15,23H,7-10,13H2,1-2H3,(H,20,24)/b14-12- |
| InChIKey | RNUIRSWQDGYAQI-OWBHPGMISA-N |
| XLogP | 0.79 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|