C19H26N4O3S — CID 108842277
(Z)-N-benzyl-2-cyano-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]prop-2-enamide (PubChem CID 108842277) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is (Z)-N-benzyl-2-cyano-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]prop-2-enamide.
| Compound Name | (Z)-N-benzyl-2-cyano-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108842277 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (Z)-N-benzyl-2-cyano-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]prop-2-enamide |
| SMILES | CN(C)CCN(/C=C(/C#N)C(=O)NCc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H26N4O3S/c1-22(2)9-10-23(18-8-11-27(25,26)15-18)14-17(12-20)19(24)21-13-16-6-4-3-5-7-16/h3-7,14,18H,8-11,13,15H2,1-2H3,(H,21,24)/b17-14- |
| InChIKey | KIIYBZIFIRRHIP-VKAVYKQESA-N |
| XLogP | 0.76 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|