C14H23N3O3S — CID 108833009
(Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-ethylamino]-N-(2-methylpropyl)prop-2-enamide (PubChem CID 108833009) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is (Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-ethylamino]-N-(2-methylpropyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-ethylamino]-N-(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 108833009 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-ethylamino]-N-(2-methylpropyl)prop-2-enamide |
| SMILES | CCN(/C=C(/C#N)C(=O)NCC(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H23N3O3S/c1-4-17(13-5-6-21(19,20)10-13)9-12(7-15)14(18)16-8-11(2)3/h9,11,13H,4-6,8,10H2,1-3H3,(H,16,18)/b12-9- |
| InChIKey | NVWTXPXHGSKYOD-XFXZXTDPSA-N |
| XLogP | 0.68 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|