C19H32N4O3S — CID 108830413
(Z)-2-cyano-N-cyclohexyl-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]-N-methylprop-2-enamide (PubChem CID 108830413) has the molecular formula C19H32N4O3S and a molecular weight of 396.56 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclohexyl-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]-N-methylprop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclohexyl-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 108830413 |
| Molecular Formula | C19H32N4O3S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (Z)-2-cyano-N-cyclohexyl-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]-N-methylprop-2-enamide |
| SMILES | CN(C)CCN(/C=C(/C#N)C(=O)N(C)C1CCCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H32N4O3S/c1-21(2)10-11-23(18-9-12-27(25,26)15-18)14-16(13-20)19(24)22(3)17-7-5-4-6-8-17/h14,17-18H,4-12,15H2,1-3H3/b16-14- |
| InChIKey | HGXVWQJMXGSAES-PEZBUJJGSA-N |
| XLogP | 1.24 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|