C22H30FN5O3S — CID 108854934
(Z)-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile (PubChem CID 108854934) has the molecular formula C22H30FN5O3S and a molecular weight of 463.58 g/mol. Its IUPAC name is (Z)-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile.
| Compound Name | (Z)-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 108854934 |
| Molecular Formula | C22H30FN5O3S |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (Z)-3-[2-(dimethylamino)ethyl-(1,1-dioxothiolan-3-yl)amino]-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile |
| SMILES | CN(C)CCN(/C=C(/C#N)C(=O)N1CCN(c2ccc(F)cc2)CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H30FN5O3S/c1-25(2)8-9-28(21-7-14-32(30,31)17-21)16-18(15-24)22(29)27-12-10-26(11-13-27)20-5-3-19(23)4-6-20/h3-6,16,21H,7-14,17H2,1-2H3/b18-16- |
| InChIKey | UMKXPPOXEQAQDV-VLGSPTGOSA-N |
| XLogP | 0.93 |
| TPSA | 87.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|