C15H24N4O4S — CID 108819986
(Z)-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]-2-(piperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 108819986) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is (Z)-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]-2-(piperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]-2-(piperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108819986 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (Z)-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]-2-(piperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | COCCN(/C=C(/C#N)C(=O)N1CCNCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H24N4O4S/c1-23-8-7-19(14-2-9-24(21,22)12-14)11-13(10-16)15(20)18-5-3-17-4-6-18/h11,14,17H,2-9,12H2,1H3/b13-11- |
| InChIKey | WWMVPNWQAQROMA-QBFSEMIESA-N |
| XLogP | -1.04 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|