C19H23N3O5S — CID 108856800
(Z)-N-(3-acetylphenyl)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]prop-2-enamide (PubChem CID 108856800) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is (Z)-N-(3-acetylphenyl)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]prop-2-enamide.
| Compound Name | (Z)-N-(3-acetylphenyl)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108856800 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (Z)-N-(3-acetylphenyl)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]prop-2-enamide |
| SMILES | COCCN(/C=C(/C#N)C(=O)Nc1cccc(C(C)=O)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H23N3O5S/c1-14(23)15-4-3-5-17(10-15)21-19(24)16(11-20)12-22(7-8-27-2)18-6-9-28(25,26)13-18/h3-5,10,12,18H,6-9,13H2,1-2H3,(H,21,24)/b16-12- |
| InChIKey | GUNDWWLEDUYODQ-VBKFSLOCSA-N |
| XLogP | 1.37 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|