C18H30N4O4S — CID 108838588
(Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide (PubChem CID 108838588) has the molecular formula C18H30N4O4S and a molecular weight of 398.53 g/mol. Its IUPAC name is (Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108838588 |
| Molecular Formula | C18H30N4O4S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide |
| SMILES | COCCN(/C=C(/C#N)C(=O)N(C)C1CCN(C)CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H30N4O4S/c1-20-7-4-16(5-8-20)21(2)18(23)15(12-19)13-22(9-10-26-3)17-6-11-27(24,25)14-17/h13,16-17H,4-11,14H2,1-3H3/b15-13- |
| InChIKey | PYIRTQZKLHMYTL-SQFISAMPSA-N |
| XLogP | 0.08 |
| TPSA | 93.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|