C19H34N4O — CID 108838632
(Z)-3-[bis(2-methylpropyl)amino]-2-cyano-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide (PubChem CID 108838632) has the molecular formula C19H34N4O and a molecular weight of 334.51 g/mol. Its IUPAC name is (Z)-3-[bis(2-methylpropyl)amino]-2-cyano-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide.
| Compound Name | (Z)-3-[bis(2-methylpropyl)amino]-2-cyano-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108838632 |
| Molecular Formula | C19H34N4O |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | (Z)-3-[bis(2-methylpropyl)amino]-2-cyano-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide |
| SMILES | CC(C)CN(/C=C(/C#N)C(=O)N(C)C1CCN(C)CC1)CC(C)C |
| InChI | InChI=1S/C19H34N4O/c1-15(2)12-23(13-16(3)4)14-17(11-20)19(24)22(6)18-7-9-21(5)10-8-18/h14-16,18H,7-10,12-13H2,1-6H3/b17-14- |
| InChIKey | VIXVAESCOGPJGU-VKAVYKQESA-N |
| XLogP | 2.56 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|