C21H30N4O — CID 108838418
(Z)-3-[benzyl(propan-2-yl)amino]-2-cyano-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide (PubChem CID 108838418) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is (Z)-3-[benzyl(propan-2-yl)amino]-2-cyano-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide.
| Compound Name | (Z)-3-[benzyl(propan-2-yl)amino]-2-cyano-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108838418 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (Z)-3-[benzyl(propan-2-yl)amino]-2-cyano-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide |
| SMILES | CC(C)N(/C=C(/C#N)C(=O)N(C)C1CCN(C)CC1)Cc1ccccc1 |
| InChI | InChI=1S/C21H30N4O/c1-17(2)25(15-18-8-6-5-7-9-18)16-19(14-22)21(26)24(4)20-10-12-23(3)13-11-20/h5-9,16-17,20H,10-13,15H2,1-4H3/b19-16- |
| InChIKey | CLPQYXZWUDDHAE-MNDPQUGUSA-N |
| XLogP | 2.86 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|