C20H33N5O3 — CID 108838749
tert-butyl 4-[(Z)-2-cyano-3-[methyl-(1-methylpiperidin-4-yl)amino]-3-oxoprop-1-enyl]piperazine-1-carboxylate (PubChem CID 108838749) has the molecular formula C20H33N5O3 and a molecular weight of 391.52 g/mol. Its IUPAC name is tert-butyl 4-[(Z)-2-cyano-3-[methyl-(1-methylpiperidin-4-yl)amino]-3-oxoprop-1-enyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(Z)-2-cyano-3-[methyl-(1-methylpiperidin-4-yl)amino]-3-oxoprop-1-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108838749 |
| Molecular Formula | C20H33N5O3 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | tert-butyl 4-[(Z)-2-cyano-3-[methyl-(1-methylpiperidin-4-yl)amino]-3-oxoprop-1-enyl]piperazine-1-carboxylate |
| SMILES | CN1CCC(N(C)C(=O)/C(C#N)=C\N2CCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H33N5O3/c1-20(2,3)28-19(27)25-12-10-24(11-13-25)15-16(14-21)18(26)23(5)17-6-8-22(4)9-7-17/h15,17H,6-13H2,1-5H3/b16-15- |
| InChIKey | SWNZWNOSFCRKLF-NXVVXOECSA-N |
| XLogP | 1.50 |
| TPSA | 80.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|