C23H30FN5O3 — CID 108855096
tert-butyl 4-[(Z)-2-cyano-3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]piperazine-1-carboxylate (PubChem CID 108855096) has the molecular formula C23H30FN5O3 and a molecular weight of 443.52 g/mol. Its IUPAC name is tert-butyl 4-[(Z)-2-cyano-3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(Z)-2-cyano-3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108855096 |
| Molecular Formula | C23H30FN5O3 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | tert-butyl 4-[(Z)-2-cyano-3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C=C(/C#N)C(=O)N2CCN(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H30FN5O3/c1-23(2,3)32-22(31)29-10-8-26(9-11-29)17-18(16-25)21(30)28-14-12-27(13-15-28)20-6-4-19(24)5-7-20/h4-7,17H,8-15H2,1-3H3/b18-17- |
| InChIKey | MGYUNZOCMVZNJH-ZCXUNETKSA-N |
| XLogP | 2.43 |
| TPSA | 80.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|