C16H18ClFN4O — CID 108854831
(Z)-3-(2-chloroethylamino)-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile (PubChem CID 108854831) has the molecular formula C16H18ClFN4O and a molecular weight of 336.80 g/mol. Its IUPAC name is (Z)-3-(2-chloroethylamino)-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile.
| Compound Name | (Z)-3-(2-chloroethylamino)-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 108854831 |
| Molecular Formula | C16H18ClFN4O |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (Z)-3-(2-chloroethylamino)-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile |
| SMILES | N#C/C(=C/NCCCl)C(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H18ClFN4O/c17-5-6-20-12-13(11-19)16(23)22-9-7-21(8-10-22)15-3-1-14(18)2-4-15/h1-4,12,20H,5-10H2/b13-12- |
| InChIKey | IHUWOOZLUIVSNZ-SEYXRHQNSA-N |
| XLogP | 1.71 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|