C20H28N6O — CID 108861976
(Z)-2-(4-methylpiperazine-1-carbonyl)-3-[4-(4-methylpiperazin-1-yl)anilino]prop-2-enenitrile (PubChem CID 108861976) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is (Z)-2-(4-methylpiperazine-1-carbonyl)-3-[4-(4-methylpiperazin-1-yl)anilino]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-methylpiperazine-1-carbonyl)-3-[4-(4-methylpiperazin-1-yl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108861976 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | (Z)-2-(4-methylpiperazine-1-carbonyl)-3-[4-(4-methylpiperazin-1-yl)anilino]prop-2-enenitrile |
| SMILES | CN1CCN(C(=O)/C(C#N)=C\Nc2ccc(N3CCN(C)CC3)cc2)CC1 |
| InChI | InChI=1S/C20H28N6O/c1-23-7-11-25(12-8-23)19-5-3-18(4-6-19)22-16-17(15-21)20(27)26-13-9-24(2)10-14-26/h3-6,16,22H,7-14H2,1-2H3/b17-16- |
| InChIKey | ZANZKLYWBPEZOW-MSUUIHNZSA-N |
| XLogP | 1.03 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|