C22H21FN4O3 — CID 108854944
methyl 4-[[(Z)-2-cyano-3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]amino]benzoate (PubChem CID 108854944) has the molecular formula C22H21FN4O3 and a molecular weight of 408.43 g/mol. Its IUPAC name is methyl 4-[[(Z)-2-cyano-3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-2-cyano-3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 108854944 |
| Molecular Formula | C22H21FN4O3 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | methyl 4-[[(Z)-2-cyano-3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N/C=C(/C#N)C(=O)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H21FN4O3/c1-30-22(29)16-2-6-19(7-3-16)25-15-17(14-24)21(28)27-12-10-26(11-13-27)20-8-4-18(23)5-9-20/h2-9,15,25H,10-13H2,1H3/b17-15- |
| InChIKey | SNZVTWBFPJFYMR-ICFOKQHNSA-N |
| XLogP | 2.78 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|